About (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene
(5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene (PubChem CID 173436018) has the molecular formula C22H35N
and a molecular weight of 313.53 g/mol. Its IUPAC name is (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene.
Molecular Properties
| Compound Name | (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene |
| PubChem CID | 173436018 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene |
| SMILES | C1=CCC/N=C(\C2CCCC3(CCCCC3)C2)CC/C=C/CC1 |
| InChI | InChI=1S/C22H35N/c1-2-4-6-11-18-23-21(14-8-5-3-1)20-13-12-17-22(19-20)15-9-7-10-16-22/h3-6,20H,1-2,7-19H2/b5-3+,6-4?,23-21- |
| InChIKey | KWLJGBJIKWNFBV-AKOBMDJLSA-N |
| XLogP | 6.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene?
The IUPAC name of (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene (CID 173436018) is (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene.
What is the SMILES notation for (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene?
The canonical SMILES for (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene is C1=CCC/N=C(\C2CCCC3(CCCCC3)C2)CC/C=C/CC1.
What is the InChIKey of (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene?
The InChIKey is KWLJGBJIKWNFBV-AKOBMDJLSA-N. The full InChI is InChI=1S/C22H35N/c1-2-4-6-11-18-23-21(14-8-5-3-1)20-13-12-17-22(19-20)15-9-7-10-16-22/h3-6,20H,1-2,7-19H2/b5-3+,6-4?,23-21-.
What are the key properties of (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene?
(5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene has a molecular weight of 313.53 g/mol, XLogP of 6.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene is sourced from PubChem (CID 173436018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).