C31H57N — CID 123919875
1-[5-(2,2-dimethylpropyl)spiro[5.5]undecan-2-yl]-N-ethyl-2-ethylidene-5-methyldecan-1-imine (PubChem CID 123919875) has the molecular formula C31H57N and a molecular weight of 443.80 g/mol. Its IUPAC name is 1-[5-(2,2-dimethylpropyl)spiro[5.5]undecan-2-yl]-N-ethyl-2-ethylidene-5-methyldecan-1-imine.
| Compound Name | 1-[5-(2,2-dimethylpropyl)spiro[5.5]undecan-2-yl]-N-ethyl-2-ethylidene-5-methyldecan-1-imine |
|---|---|
| PubChem CID | 123919875 |
| Molecular Formula | C31H57N |
| Molecular Weight | 443.80 g/mol |
| Exact Mass | 443.45 |
| IUPAC Name | 1-[5-(2,2-dimethylpropyl)spiro[5.5]undecan-2-yl]-N-ethyl-2-ethylidene-5-methyldecan-1-imine |
| SMILES | CC=C(CCC(C)CCCCC)/C(=N\CC)C1CCC(CC(C)(C)C)C2(CCCCC2)C1 |
| InChI | InChI=1S/C31H57N/c1-8-11-13-16-25(4)17-18-26(9-2)29(32-10-3)27-19-20-28(24-30(5,6)7)31(23-27)21-14-12-15-22-31/h9,25,27-28H,8,10-24H2,1-7H3/b26-9?,32-29+ |
| InChIKey | NOMJWFRQCSQLGN-IRDMQLHXSA-N |
| XLogP | 10.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.80 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|