C23H37N — CID 70991671
N,7-dimethyl-8-(2-methylcyclopropyl)-7-propan-2-yl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-imine (PubChem CID 70991671) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is N,7-dimethyl-8-(2-methylcyclopropyl)-7-propan-2-yl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-imine.
| Compound Name | N,7-dimethyl-8-(2-methylcyclopropyl)-7-propan-2-yl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-imine |
|---|---|
| PubChem CID | 70991671 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | N,7-dimethyl-8-(2-methylcyclopropyl)-7-propan-2-yl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-imine |
| SMILES | C/N=C1/C=C2CCC3C(CCC(C)(C(C)C)C3C3CC3C)C2CC1 |
| InChI | InChI=1S/C23H37N/c1-14(2)23(4)11-10-19-18-9-7-17(24-5)13-16(18)6-8-20(19)22(23)21-12-15(21)3/h13-15,18-22H,6-12H2,1-5H3/b24-17+ |
| InChIKey | LAGWOIUBGRMOFG-JJIBRWJFSA-N |
| XLogP | 6.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|