About 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine
2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine (PubChem CID 138498225) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine |
| PubChem CID | 138498225 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine |
| SMILES | CCCCCCC1(C)CCCC(C2CC=CC(C)=N2)C1C |
| InChI | InChI=1S/C20H35N/c1-5-6-7-8-14-20(4)15-10-12-18(17(20)3)19-13-9-11-16(2)21-19/h9,11,17-19H,5-8,10,12-15H2,1-4H3 |
| InChIKey | GESOUSCMXOUYKO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine?
The IUPAC name of 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine (CID 138498225) is 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine.
What is the SMILES notation for 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine?
The canonical SMILES for 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine is CCCCCCC1(C)CCCC(C2CC=CC(C)=N2)C1C.
What is the InChIKey of 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine?
The InChIKey is GESOUSCMXOUYKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N/c1-5-6-7-8-14-20(4)15-10-12-18(17(20)3)19-13-9-11-16(2)21-19/h9,11,17-19H,5-8,10,12-15H2,1-4H3.
What are the key properties of 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine?
2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine has a molecular weight of 289.51 g/mol, XLogP of 6.19, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine is sourced from PubChem (CID 138498225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).