C20H35N — CID 138498225
2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine (PubChem CID 138498225) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine.
| Compound Name | 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 138498225 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 2-(3-hexyl-2,3-dimethylcyclohexyl)-6-methyl-2,3-dihydropyridine |
| SMILES | CCCCCCC1(C)CCCC(C2CC=CC(C)=N2)C1C |
| InChI | InChI=1S/C20H35N/c1-5-6-7-8-14-20(4)15-10-12-18(17(20)3)19-13-9-11-16(2)21-19/h9,11,17-19H,5-8,10,12-15H2,1-4H3 |
| InChIKey | GESOUSCMXOUYKO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|