C16H30 — CID 163618137
7-hexyl-7,8-dimethylbicyclo[4.2.0]octane (PubChem CID 163618137) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 7-hexyl-7,8-dimethylbicyclo[4.2.0]octane.
| Compound Name | 7-hexyl-7,8-dimethylbicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 163618137 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 7-hexyl-7,8-dimethylbicyclo[4.2.0]octane |
| SMILES | CCCCCCC1(C)C(C)C2CCCCC21 |
| InChI | InChI=1S/C16H30/c1-4-5-6-9-12-16(3)13(2)14-10-7-8-11-15(14)16/h13-15H,4-12H2,1-3H3 |
| InChIKey | HLSZEGVJKZCEQA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|