C13H26 — CID 90804985
1,2-dimethyl-1-pentyl-3-propan-2-ylcyclopropane (PubChem CID 90804985) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 1,2-dimethyl-1-pentyl-3-propan-2-ylcyclopropane.
| Compound Name | 1,2-dimethyl-1-pentyl-3-propan-2-ylcyclopropane |
|---|---|
| PubChem CID | 90804985 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 1,2-dimethyl-1-pentyl-3-propan-2-ylcyclopropane |
| SMILES | CCCCCC1(C)C(C)C1C(C)C |
| InChI | InChI=1S/C13H26/c1-6-7-8-9-13(5)11(4)12(13)10(2)3/h10-12H,6-9H2,1-5H3 |
| InChIKey | POYMVFGNSIUKQV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|