C12H24 — CID 123224943
1,2,3-trimethyl-1-(4-methylpentyl)cyclopropane (PubChem CID 123224943) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is 1,2,3-trimethyl-1-(4-methylpentyl)cyclopropane.
| Compound Name | 1,2,3-trimethyl-1-(4-methylpentyl)cyclopropane |
|---|---|
| PubChem CID | 123224943 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 1,2,3-trimethyl-1-(4-methylpentyl)cyclopropane |
| SMILES | CC(C)CCCC1(C)C(C)C1C |
| InChI | InChI=1S/C12H24/c1-9(2)7-6-8-12(5)10(3)11(12)4/h9-11H,6-8H2,1-5H3 |
| InChIKey | SKSAEHVOOFVMPQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |