C18H34O — CID 163550704
6-ethyl-2,3,4,5-tetramethyl-2-pentylcyclohexane-1-carbaldehyde (PubChem CID 163550704) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is 6-ethyl-2,3,4,5-tetramethyl-2-pentylcyclohexane-1-carbaldehyde.
| Compound Name | 6-ethyl-2,3,4,5-tetramethyl-2-pentylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 163550704 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | 6-ethyl-2,3,4,5-tetramethyl-2-pentylcyclohexane-1-carbaldehyde |
| SMILES | CCCCCC1(C)C(C)C(C)C(C)C(CC)C1C=O |
| InChI | InChI=1S/C18H34O/c1-7-9-10-11-18(6)15(5)13(3)14(4)16(8-2)17(18)12-19/h12-17H,7-11H2,1-6H3 |
| InChIKey | FIURVNLTWWWZJX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|