C13H23NO — CID 163488564
(1R,3R)-1,4-dimethyl-3-nitroso-3-pentylbicyclo[3.1.0]hexane (PubChem CID 163488564) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (1R,3R)-1,4-dimethyl-3-nitroso-3-pentylbicyclo[3.1.0]hexane.
| Compound Name | (1R,3R)-1,4-dimethyl-3-nitroso-3-pentylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 163488564 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (1R,3R)-1,4-dimethyl-3-nitroso-3-pentylbicyclo[3.1.0]hexane |
| SMILES | CCCCC[C@@]1(N=O)C[C@@]2(C)CC2C1C |
| InChI | InChI=1S/C13H23NO/c1-4-5-6-7-13(14-15)9-12(3)8-11(12)10(13)2/h10-11H,4-9H2,1-3H3/t10?,11?,12-,13-/m1/s1 |
| InChIKey | CKQHSOPEXWWZPT-FIYWTHMPSA-N |
| XLogP | 4.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|