C32H64 — CID 123419032
4-butan-2-yl-1-hexyl-1,3,4,8,8-pentamethyl-5-pentan-3-yl-2-propan-2-ylcyclononane (PubChem CID 123419032) has the molecular formula C32H64 and a molecular weight of 448.86 g/mol. Its IUPAC name is 4-butan-2-yl-1-hexyl-1,3,4,8,8-pentamethyl-5-pentan-3-yl-2-propan-2-ylcyclononane.
| Compound Name | 4-butan-2-yl-1-hexyl-1,3,4,8,8-pentamethyl-5-pentan-3-yl-2-propan-2-ylcyclononane |
|---|---|
| PubChem CID | 123419032 |
| Molecular Formula | C32H64 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.50 |
| IUPAC Name | 4-butan-2-yl-1-hexyl-1,3,4,8,8-pentamethyl-5-pentan-3-yl-2-propan-2-ylcyclononane |
| SMILES | CCCCCCC1(C)CC(C)(C)CCC(C(CC)CC)C(C)(C(C)CC)C(C)C1C(C)C |
| InChI | InChI=1S/C32H64/c1-13-17-18-19-21-31(11)23-30(9,10)22-20-28(27(15-3)16-4)32(12,25(7)14-2)26(8)29(31)24(5)6/h24-29H,13-23H2,1-12H3 |
| InChIKey | MDBWHXASVJSFFE-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|