C13H17N — CID 91181236
1,4,4a,5,6,7,9,9a-octahydroacridine (PubChem CID 91181236) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1,4,4a,5,6,7,9,9a-octahydroacridine.
| Compound Name | 1,4,4a,5,6,7,9,9a-octahydroacridine |
|---|---|
| PubChem CID | 91181236 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1,4,4a,5,6,7,9,9a-octahydroacridine |
| SMILES | C1=CCC2N=C3CCCC=C3CC2C1 |
| InChI | InChI=1S/C13H17N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1,3,6,10,12H,2,4-5,7-9H2 |
| InChIKey | FGDQYHJKLMDAOB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|