C12H15N — CID 123552988
3a,7,8,8a,9,9a-hexahydro-3H-cyclopenta[b]quinoline (PubChem CID 123552988) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 3a,7,8,8a,9,9a-hexahydro-3H-cyclopenta[b]quinoline.
| Compound Name | 3a,7,8,8a,9,9a-hexahydro-3H-cyclopenta[b]quinoline |
|---|---|
| PubChem CID | 123552988 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3a,7,8,8a,9,9a-hexahydro-3H-cyclopenta[b]quinoline |
| SMILES | C1=CC2=NC3CC=CC3CC2CC1 |
| InChI | InChI=1S/C12H15N/c1-2-6-11-9(4-1)8-10-5-3-7-12(10)13-11/h2-3,5-6,9-10,12H,1,4,7-8H2 |
| InChIKey | LOYQDKBWCPCEND-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|