C12H15N — CID 54099942
3,3a,4,4a,8a,9-hexahydro-2H-benzo[f]indole (PubChem CID 54099942) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,3a,4,4a,8a,9-hexahydro-2H-benzo[f]indole.
| Compound Name | 3,3a,4,4a,8a,9-hexahydro-2H-benzo[f]indole |
|---|---|
| PubChem CID | 54099942 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3,3a,4,4a,8a,9-hexahydro-2H-benzo[f]indole |
| SMILES | C1=CC2CC3=NCCC3CC2C=C1 |
| InChI | InChI=1S/C12H15N/c1-2-4-10-8-12-11(5-6-13-12)7-9(10)3-1/h1-4,9-11H,5-8H2 |
| InChIKey | MZVUNAGQELTURH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |