C13H17N — CID 54082293
(4aS,5aR)-2,3,4,4a,5,5a,9a,10-octahydrobenzo[g]quinoline (PubChem CID 54082293) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (4aS,5aR)-2,3,4,4a,5,5a,9a,10-octahydrobenzo[g]quinoline.
| Compound Name | (4aS,5aR)-2,3,4,4a,5,5a,9a,10-octahydrobenzo[g]quinoline |
|---|---|
| PubChem CID | 54082293 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (4aS,5aR)-2,3,4,4a,5,5a,9a,10-octahydrobenzo[g]quinoline |
| SMILES | C1=CC2CC3=NCCC[C@H]3C[C@@H]2C=C1 |
| InChI | InChI=1S/C13H17N/c1-2-5-11-9-13-12(6-3-7-14-13)8-10(11)4-1/h1-2,4-5,10-12H,3,6-9H2/t10-,11?,12-/m0/s1 |
| InChIKey | MNYOVPHNJCJRCM-PRWSFJOGSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |