C26H40N2 — CID 54606180
(E,Z)-4-(2,6,6-trimethylcyclohexen-1-yl)-N-[(Z)-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]but-3-en-2-imine (PubChem CID 54606180) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is (E,Z)-4-(2,6,6-trimethylcyclohexen-1-yl)-N-[(Z)-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]but-3-en-2-imine.
| Compound Name | (E,Z)-4-(2,6,6-trimethylcyclohexen-1-yl)-N-[(Z)-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]but-3-en-2-imine |
|---|---|
| PubChem CID | 54606180 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | (E,Z)-4-(2,6,6-trimethylcyclohexen-1-yl)-N-[(Z)-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]but-3-en-2-imine |
| SMILES | CC1=C(/C=C\C(C)=N\N=C(C)/C=C/C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H40N2/c1-19-11-9-17-25(5,6)23(19)15-13-21(3)27-28-22(4)14-16-24-20(2)12-10-18-26(24,7)8/h13-16H,9-12,17-18H2,1-8H3/b15-13-,16-14+,27-21+,28-22- |
| InChIKey | SQYSFXIDGKWUEA-OXNPOLRYSA-N |
| XLogP | 7.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|