C16H23N — CID 91076155
4-(8-methyl-2,5,8,9-tetrahydro-1H-benzo[7]annulen-6-yl)butan-2-imine (PubChem CID 91076155) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 4-(8-methyl-2,5,8,9-tetrahydro-1H-benzo[7]annulen-6-yl)butan-2-imine.
| Compound Name | 4-(8-methyl-2,5,8,9-tetrahydro-1H-benzo[7]annulen-6-yl)butan-2-imine |
|---|---|
| PubChem CID | 91076155 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 4-(8-methyl-2,5,8,9-tetrahydro-1H-benzo[7]annulen-6-yl)butan-2-imine |
| SMILES | [H]/N=C(\C)CCC1=CC(C)CC2=C(C=CCC2)C1 |
| InChI | InChI=1S/C16H23N/c1-12-9-14(8-7-13(2)17)11-16-6-4-3-5-15(16)10-12/h4,6,9,12,17H,3,5,7-8,10-11H2,1-2H3/b17-13+ |
| InChIKey | PUSMAGHVUKNFAP-GHRIWEEISA-N |
| XLogP | 4.81 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|