C24H35N — CID 91318570
2-(2-ethenylidene-3-propylhexyl)-5-(3-methylpenta-1,3-dien-2-yl)cyclohepta-2,6-dien-1-imine (PubChem CID 91318570) has the molecular formula C24H35N and a molecular weight of 337.55 g/mol. Its IUPAC name is 2-(2-ethenylidene-3-propylhexyl)-5-(3-methylpenta-1,3-dien-2-yl)cyclohepta-2,6-dien-1-imine.
| Compound Name | 2-(2-ethenylidene-3-propylhexyl)-5-(3-methylpenta-1,3-dien-2-yl)cyclohepta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 91318570 |
| Molecular Formula | C24H35N |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 2-(2-ethenylidene-3-propylhexyl)-5-(3-methylpenta-1,3-dien-2-yl)cyclohepta-2,6-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(C(=C)C(C)=CC)CC=C1CC(=C=C)C(CCC)CCC |
| InChI | InChI=1S/C24H35N/c1-7-11-22(12-8-2)20(10-4)17-23-14-13-21(15-16-24(23)25)19(6)18(5)9-3/h9,14-16,21-22,25H,4,6-8,11-13,17H2,1-3,5H3/b18-9?,25-24+ |
| InChIKey | QYRGYOQUCXBXAV-MRHKATQMSA-N |
| XLogP | 7.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|