C34H53BFN — CID 91266149
4-butan-2-ylidene-6-ethyl-9-[2-[6-(3-fluoro-2-methylpenta-1,4-dien-3-yl)-2H-borepin-3-yl]ethyl]-9,10-dimethyldodec-1-en-3-imine (PubChem CID 91266149) has the molecular formula C34H53BFN and a molecular weight of 505.62 g/mol. Its IUPAC name is 4-butan-2-ylidene-6-ethyl-9-[2-[6-(3-fluoro-2-methylpenta-1,4-dien-3-yl)-2H-borepin-3-yl]ethyl]-9,10-dimethyldodec-1-en-3-imine.
| Compound Name | 4-butan-2-ylidene-6-ethyl-9-[2-[6-(3-fluoro-2-methylpenta-1,4-dien-3-yl)-2H-borepin-3-yl]ethyl]-9,10-dimethyldodec-1-en-3-imine |
|---|---|
| PubChem CID | 91266149 |
| Molecular Formula | C34H53BFN |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.43 |
| IUPAC Name | 4-butan-2-ylidene-6-ethyl-9-[2-[6-(3-fluoro-2-methylpenta-1,4-dien-3-yl)-2H-borepin-3-yl]ethyl]-9,10-dimethyldodec-1-en-3-imine |
| SMILES | [H]/N=C(\C=C)C(CC(CC)CCC(C)(CCC1=CC=C(C(F)(C=C)C(=C)C)C=BC1)C(C)CC)=C(C)CC |
| InChI | InChI=1S/C34H53BFN/c1-11-26(8)31(32(37)14-4)22-28(13-3)18-20-33(10,27(9)12-2)21-19-29-16-17-30(24-35-23-29)34(36,15-5)25(6)7/h14-17,24,27-28,37H,4-6,11-13,18-23H2,1-3,7-10H3/b31-26?,37-32+ |
| InChIKey | FNBMERMCOXPWSC-VATABHFTSA-N |
| XLogP | 10.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|