C29H43N — CID 123161981
3-[5-(6-ethylcyclohepta-1,3,4-trien-1-yl)hept-4-en-2-yl]-4-(4-methylhex-5-en-2-yl)cyclohex-2-en-1-imine (PubChem CID 123161981) has the molecular formula C29H43N and a molecular weight of 405.67 g/mol. Its IUPAC name is 3-[5-(6-ethylcyclohepta-1,3,4-trien-1-yl)hept-4-en-2-yl]-4-(4-methylhex-5-en-2-yl)cyclohex-2-en-1-imine.
| Compound Name | 3-[5-(6-ethylcyclohepta-1,3,4-trien-1-yl)hept-4-en-2-yl]-4-(4-methylhex-5-en-2-yl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123161981 |
| Molecular Formula | C29H43N |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | 3-[5-(6-ethylcyclohepta-1,3,4-trien-1-yl)hept-4-en-2-yl]-4-(4-methylhex-5-en-2-yl)cyclohex-2-en-1-imine |
| SMILES | [H]/N=C1/C=C(C(C)CC=C(CC)C2=CC=C=CC(CC)C2)C(C(C)CC(C)C=C)CC1 |
| InChI | InChI=1S/C29H43N/c1-7-21(4)18-23(6)28-17-16-27(30)20-29(28)22(5)14-15-25(9-3)26-13-11-10-12-24(8-2)19-26/h7,11-13,15,20-24,28,30H,1,8-9,14,16-19H2,2-6H3/b25-15?,30-27+ |
| InChIKey | JQNSNQKUUBRTOY-OMNJLFITSA-N |
| XLogP | 8.62 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|