About 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride
2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride (PubChem CID 68952498) has the molecular formula C12H19Cl2FeN
and a molecular weight of 304.04 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride.
Molecular Properties
| Compound Name | 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride |
| PubChem CID | 68952498 |
| Molecular Formula | C12H19Cl2FeN |
| Molecular Weight | 304.04 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride |
| SMILES | [Cl-].[Cl-].[Fe+2].[H]/N=C1/C(C(C)C)=CC=CC1C(C)C |
| InChI | InChI=1S/C12H19N.2ClH.Fe/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;;;/h5-10,13H,1-4H3;2*1H;/q;;;+2/p-2/b13-12+;;; |
| InChIKey | GZOLVICXVSUSJQ-RMUFJAKESA-L |
| XLogP | -2.56 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.04 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride?
The IUPAC name of 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride (CID 68952498) is 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride.
What is the SMILES notation for 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride?
The canonical SMILES for 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride is [Cl-].[Cl-].[Fe+2].[H]/N=C1/C(C(C)C)=CC=CC1C(C)C.
What is the InChIKey of 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride?
The InChIKey is GZOLVICXVSUSJQ-RMUFJAKESA-L. The full InChI is InChI=1S/C12H19N.2ClH.Fe/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;;;/h5-10,13H,1-4H3;2*1H;/q;;;+2/p-2/b13-12+;;;.
What are the key properties of 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride?
2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride has a molecular weight of 304.04 g/mol, XLogP of -2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-imine;iron(2+);dichloride is sourced from PubChem (CID 68952498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).