C12H16N2 — CID 134859228
6-(2-iminocyclohexyl)cyclohexa-2,4-dien-1-imine (PubChem CID 134859228) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-(2-iminocyclohexyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | 6-(2-iminocyclohexyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 134859228 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6-(2-iminocyclohexyl)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC1C1CCCC/C1=N\[H] |
| InChI | InChI=1S/C12H16N2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1,3,5,7,9-10,13-14H,2,4,6,8H2/b13-11+,14-12+ |
| InChIKey | WTRJFQUSHRTIND-PHEQNACWSA-N |
| XLogP | 2.96 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|