C20H33N — CID 129274500
4-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-2,2,5,5-tetramethylheptan-3-imine (PubChem CID 129274500) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 4-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-2,2,5,5-tetramethylheptan-3-imine.
| Compound Name | 4-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-2,2,5,5-tetramethylheptan-3-imine |
|---|---|
| PubChem CID | 129274500 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 4-(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-2,2,5,5-tetramethylheptan-3-imine |
| SMILES | [H]/N=C(/C(C1=CC(C)(C)C=CC=C1)C(C)(C)CC)C(C)(C)C |
| InChI | InChI=1S/C20H33N/c1-9-20(7,8)16(17(21)18(2,3)4)15-12-10-11-13-19(5,6)14-15/h10-14,16,21H,9H2,1-8H3/b21-17- |
| InChIKey | ANOYDMRSXIDHNX-FXBPSFAMSA-N |
| XLogP | 6.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|