C15H20N2 — CID 90793702
2-cyclohexa-1,5-dien-1-yl-6,6-dimethylcyclohept-2-ene-1,4-diimine (PubChem CID 90793702) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-6,6-dimethylcyclohept-2-ene-1,4-diimine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-6,6-dimethylcyclohept-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 90793702 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-6,6-dimethylcyclohept-2-ene-1,4-diimine |
| SMILES | [H]/N=C1/C=C(C2=CCCC=C2)/C(=N/[H])CC(C)(C)C1 |
| InChI | InChI=1S/C15H20N2/c1-15(2)9-12(16)8-13(14(17)10-15)11-6-4-3-5-7-11/h4,6-8,16-17H,3,5,9-10H2,1-2H3/b16-12-,17-14+ |
| InChIKey | VOSGLPQZPCCZHD-CCMYLADUSA-N |
| XLogP | 4.05 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|