C14H25N — CID 87279105
(4R)-2-[(1S)-cyclohex-2-en-1-yl]-2,4-dimethylhexan-3-imine (PubChem CID 87279105) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (4R)-2-[(1S)-cyclohex-2-en-1-yl]-2,4-dimethylhexan-3-imine.
| Compound Name | (4R)-2-[(1S)-cyclohex-2-en-1-yl]-2,4-dimethylhexan-3-imine |
|---|---|
| PubChem CID | 87279105 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (4R)-2-[(1S)-cyclohex-2-en-1-yl]-2,4-dimethylhexan-3-imine |
| SMILES | [H]/N=C(\[C@H](C)CC)C(C)(C)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C14H25N/c1-5-11(2)13(15)14(3,4)12-9-7-6-8-10-12/h7,9,11-12,15H,5-6,8,10H2,1-4H3/b15-13+/t11-,12-/m1/s1 |
| InChIKey | GEEPSTKTLFFIIA-IDNUSFOCSA-N |
| XLogP | 4.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|