C49H95N — CID 88658812
(9Z,30Z)-19,21-dimethyl-19,21-bis(2-methylpropyl)nonatriaconta-9,30-dien-20-imine (PubChem CID 88658812) has the molecular formula C49H95N and a molecular weight of 698.31 g/mol. Its IUPAC name is (9Z,30Z)-19,21-dimethyl-19,21-bis(2-methylpropyl)nonatriaconta-9,30-dien-20-imine.
| Compound Name | (9Z,30Z)-19,21-dimethyl-19,21-bis(2-methylpropyl)nonatriaconta-9,30-dien-20-imine |
|---|---|
| PubChem CID | 88658812 |
| Molecular Formula | C49H95N |
| Molecular Weight | 698.31 g/mol |
| Exact Mass | 697.75 |
| IUPAC Name | (9Z,30Z)-19,21-dimethyl-19,21-bis(2-methylpropyl)nonatriaconta-9,30-dien-20-imine |
| SMILES | [H]N=C(C(C)(CCCCCCCC/C=C\CCCCCCCC)CC(C)C)C(C)(CCCCCCCC/C=C\CCCCCCCC)CC(C)C |
| InChI | InChI=1S/C49H95N/c1-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-48(7,43-45(3)4)47(50)49(8,44-46(5)6)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-2/h23-26,45-46,50H,9-22,27-44H2,1-8H3/b25-23-,26-24-,50-47? |
| InChIKey | NUEVRJTYSBAIIX-QUAZHZRUSA-N |
| XLogP | 17.97 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.31 |
| LogP ≤ 5 | 17.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|