C26H53AlO2 — CID 175578247
alumane;(Z)-2,2-bis(2-methylpropyl)octadec-9-enoic acid (PubChem CID 175578247) has the molecular formula C26H53AlO2 and a molecular weight of 424.69 g/mol. Its IUPAC name is alumane;(Z)-2,2-bis(2-methylpropyl)octadec-9-enoic acid.
| Compound Name | alumane;(Z)-2,2-bis(2-methylpropyl)octadec-9-enoic acid |
|---|---|
| PubChem CID | 175578247 |
| Molecular Formula | C26H53AlO2 |
| Molecular Weight | 424.69 g/mol |
| Exact Mass | 424.39 |
| IUPAC Name | alumane;(Z)-2,2-bis(2-methylpropyl)octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCC(CC(C)C)(CC(C)C)C(=O)O.[AlH3] |
| InChI | InChI=1S/C26H50O2.Al.3H/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(25(27)28,21-23(2)3)22-24(4)5;;;;/h13-14,23-24H,6-12,15-22H2,1-5H3,(H,27,28);;;;/b14-13-;;;; |
| InChIKey | ICJVRRQTHXMKQW-MHRKHEJKSA-N |
| XLogP | 7.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|