C24H44O6 — CID 88550484
(9Z,12Z)-2,2-bis(2,3-dihydroxypropyl)octadeca-9,12-dienoic acid (PubChem CID 88550484) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is (9Z,12Z)-2,2-bis(2,3-dihydroxypropyl)octadeca-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-2,2-bis(2,3-dihydroxypropyl)octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 88550484 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (9Z,12Z)-2,2-bis(2,3-dihydroxypropyl)octadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(CC(O)CO)(CC(O)CO)C(=O)O |
| InChI | InChI=1S/C24H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-24(23(29)30,17-21(27)19-25)18-22(28)20-26/h6-7,9-10,21-22,25-28H,2-5,8,11-20H2,1H3,(H,29,30)/b7-6-,10-9- |
| InChIKey | RAOZYNKZHPONNS-HZJYTTRNSA-N |
| XLogP | 3.97 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|