C39H74O3 — CID 140658654
(12Z,15Z)-3-[(Z)-octadec-9-enyl]henicosa-12,15-diene-1,2,3-triol (PubChem CID 140658654) has the molecular formula C39H74O3 and a molecular weight of 591.02 g/mol. Its IUPAC name is (12Z,15Z)-3-[(Z)-octadec-9-enyl]henicosa-12,15-diene-1,2,3-triol.
| Compound Name | (12Z,15Z)-3-[(Z)-octadec-9-enyl]henicosa-12,15-diene-1,2,3-triol |
|---|---|
| PubChem CID | 140658654 |
| Molecular Formula | C39H74O3 |
| Molecular Weight | 591.02 g/mol |
| Exact Mass | 590.56 |
| IUPAC Name | (12Z,15Z)-3-[(Z)-octadec-9-enyl]henicosa-12,15-diene-1,2,3-triol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\CCCCCCCC)C(O)CO |
| InChI | InChI=1S/C39H74O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(42,38(41)37-40)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,38,40-42H,3-10,12,14-16,21-37H2,1-2H3/b13-11-,19-17-,20-18- |
| InChIKey | OPKUILLIXBPMNM-LTEAFHAISA-N |
| XLogP | 11.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.02 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|