C17H25N — CID 91130436
6-methyl-6-(4-methylpenta-1,2-dien-3-yl)-3-propan-2-ylcyclohepta-2,4-dien-1-imine (PubChem CID 91130436) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 6-methyl-6-(4-methylpenta-1,2-dien-3-yl)-3-propan-2-ylcyclohepta-2,4-dien-1-imine.
| Compound Name | 6-methyl-6-(4-methylpenta-1,2-dien-3-yl)-3-propan-2-ylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 91130436 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 6-methyl-6-(4-methylpenta-1,2-dien-3-yl)-3-propan-2-ylcyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=C(C(C)C)C=CC(C)(C(=C=C)C(C)C)C1 |
| InChI | InChI=1S/C17H25N/c1-7-16(13(4)5)17(6)9-8-14(12(2)3)10-15(18)11-17/h8-10,12-13,18H,1,11H2,2-6H3/b18-15+ |
| InChIKey | SMBBAKOYTWFEPH-OBGWFSINSA-N |
| XLogP | 4.92 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|