C20H33N — CID 90856571
1-cyclopentyl-4,9-dimethyl-6-prop-1-enyldeca-6,8-dien-3-imine (PubChem CID 90856571) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 1-cyclopentyl-4,9-dimethyl-6-prop-1-enyldeca-6,8-dien-3-imine.
| Compound Name | 1-cyclopentyl-4,9-dimethyl-6-prop-1-enyldeca-6,8-dien-3-imine |
|---|---|
| PubChem CID | 90856571 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 1-cyclopentyl-4,9-dimethyl-6-prop-1-enyldeca-6,8-dien-3-imine |
| SMILES | [H]/N=C(/CCC1CCCC1)C(C)CC(C=CC)=CC=C(C)C |
| InChI | InChI=1S/C20H33N/c1-5-8-19(12-11-16(2)3)15-17(4)20(21)14-13-18-9-6-7-10-18/h5,8,11-12,17-18,21H,6-7,9-10,13-15H2,1-4H3/b8-5?,19-12?,21-20- |
| InChIKey | XYPDGJMGJMOXMT-JXOHVDBCSA-N |
| XLogP | 6.47 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|