C21H41N — CID 90701374
3,4-dimethylnonadec-4-en-2-imine (PubChem CID 90701374) has the molecular formula C21H41N and a molecular weight of 307.57 g/mol. Its IUPAC name is 3,4-dimethylnonadec-4-en-2-imine.
| Compound Name | 3,4-dimethylnonadec-4-en-2-imine |
|---|---|
| PubChem CID | 90701374 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | 3,4-dimethylnonadec-4-en-2-imine |
| SMILES | [H]/N=C(\C)C(C)C(C)=CCCCCCCCCCCCCCC |
| InChI | InChI=1S/C21H41N/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20(3)21(4)22/h18,20,22H,5-17H2,1-4H3/b19-18?,22-21+ |
| InChIKey | ZVYMZKVMJUDYEU-OIEMDWLISA-N |
| XLogP | 7.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|