C23H39N — CID 88555340
(5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine (PubChem CID 88555340) has the molecular formula C23H39N and a molecular weight of 329.57 g/mol. Its IUPAC name is (5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine.
| Compound Name | (5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine |
|---|---|
| PubChem CID | 88555340 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | (5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine |
| SMILES | [H]/N=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H39N/c1-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-10-18-23(6)24/h11,13,15,17,24H,7-10,12,14,16,18H2,1-6H3/b20-13+,21-15+,22-17+,24-23+ |
| InChIKey | QRSGYRFEZNDJOR-YQCHTKHWSA-N |
| XLogP | 7.95 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|