C13H24N2 — CID 134876331
(E)-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]hydrazine (PubChem CID 134876331) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (E)-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]hydrazine.
| Compound Name | (E)-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]hydrazine |
|---|---|
| PubChem CID | 134876331 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (E)-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]hydrazine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=N/N |
| InChI | InChI=1S/C13H24N2/c1-11(2)7-5-8-12(3)9-6-10-13(4)15-14/h7,9H,5-6,8,10,14H2,1-4H3/b12-9+,15-13+ |
| InChIKey | HETLRJWNLKOAMU-QQFPHPJOSA-N |
| XLogP | 3.79 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|