C9H14N2 — CID 91336852
(3E)-3,6-dimethylhepta-3,6-diene-2,5-diimine (PubChem CID 91336852) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (3E)-3,6-dimethylhepta-3,6-diene-2,5-diimine.
| Compound Name | (3E)-3,6-dimethylhepta-3,6-diene-2,5-diimine |
|---|---|
| PubChem CID | 91336852 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (3E)-3,6-dimethylhepta-3,6-diene-2,5-diimine |
| SMILES | [H]/N=C(/C=C(C)/C(C)=N/[H])C(=C)C |
| InChI | InChI=1S/C9H14N2/c1-6(2)9(11)5-7(3)8(4)10/h5,10-11H,1H2,2-4H3/b7-5+,10-8+,11-9- |
| InChIKey | QIDIMAZLELDSJD-XKAPECRISA-N |
| XLogP | 2.57 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|