C12H24N2 — CID 87771116
2,2,5,6,6-pentamethylhept-4-en-3-ylidenehydrazine (PubChem CID 87771116) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2,2,5,6,6-pentamethylhept-4-en-3-ylidenehydrazine.
| Compound Name | 2,2,5,6,6-pentamethylhept-4-en-3-ylidenehydrazine |
|---|---|
| PubChem CID | 87771116 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2,2,5,6,6-pentamethylhept-4-en-3-ylidenehydrazine |
| SMILES | CC(=CC(=NN)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-9(11(2,3)4)8-10(14-13)12(5,6)7/h8H,13H2,1-7H3 |
| InChIKey | ZCKKKENUDPCBLU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|