C9H14N2 — CID 123805728
(Z)-(4,4-dimethylcyclohepta-2,6-dien-1-ylidene)hydrazine (PubChem CID 123805728) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (Z)-(4,4-dimethylcyclohepta-2,6-dien-1-ylidene)hydrazine.
| Compound Name | (Z)-(4,4-dimethylcyclohepta-2,6-dien-1-ylidene)hydrazine |
|---|---|
| PubChem CID | 123805728 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (Z)-(4,4-dimethylcyclohepta-2,6-dien-1-ylidene)hydrazine |
| SMILES | CC1(C)C=C/C(=N\N)C=CC1 |
| InChI | InChI=1S/C9H14N2/c1-9(2)6-3-4-8(11-10)5-7-9/h3-5,7H,6,10H2,1-2H3/b11-8- |
| InChIKey | ODGQJBNHLYGUFN-FLIBITNWSA-N |
| XLogP | 1.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|