C8H12N2 — CID 123731420
(E)-(4-methylcyclohepta-2,6-dien-1-ylidene)hydrazine (PubChem CID 123731420) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (E)-(4-methylcyclohepta-2,6-dien-1-ylidene)hydrazine.
| Compound Name | (E)-(4-methylcyclohepta-2,6-dien-1-ylidene)hydrazine |
|---|---|
| PubChem CID | 123731420 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (E)-(4-methylcyclohepta-2,6-dien-1-ylidene)hydrazine |
| SMILES | CC1C=C/C(=N/N)C=CC1 |
| InChI | InChI=1S/C8H12N2/c1-7-3-2-4-8(10-9)6-5-7/h2,4-7H,3,9H2,1H3/b10-8+ |
| InChIKey | UOKOEVXOZXPELY-CSKARUKUSA-N |
| XLogP | 1.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|