C9H12FN — CID 123673350
2-fluoro-4,4-dimethylcyclohepta-2,6-dien-1-imine (PubChem CID 123673350) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is 2-fluoro-4,4-dimethylcyclohepta-2,6-dien-1-imine.
| Compound Name | 2-fluoro-4,4-dimethylcyclohepta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 123673350 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 2-fluoro-4,4-dimethylcyclohepta-2,6-dien-1-imine |
| SMILES | [H]/N=C1\C=CCC(C)(C)C=C1F |
| InChI | InChI=1S/C9H12FN/c1-9(2)5-3-4-8(11)7(10)6-9/h3-4,6,11H,5H2,1-2H3/b11-8+ |
| InChIKey | PKXHFNMDTUCOCP-DHZHZOJOSA-N |
| XLogP | 2.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|