C12H20N2 — CID 123583253
(E)-(4,4,7,7-tetramethylcycloocta-2,5-dien-1-ylidene)hydrazine (PubChem CID 123583253) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (E)-(4,4,7,7-tetramethylcycloocta-2,5-dien-1-ylidene)hydrazine.
| Compound Name | (E)-(4,4,7,7-tetramethylcycloocta-2,5-dien-1-ylidene)hydrazine |
|---|---|
| PubChem CID | 123583253 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (E)-(4,4,7,7-tetramethylcycloocta-2,5-dien-1-ylidene)hydrazine |
| SMILES | CC1(C)C=C/C(=N/N)CC(C)(C)C=C1 |
| InChI | InChI=1S/C12H20N2/c1-11(2)6-5-10(14-13)9-12(3,4)8-7-11/h5-8H,9,13H2,1-4H3/b6-5?,8-7?,14-10- |
| InChIKey | VSXOFGLCYHIMPF-IZPBEGCPSA-N |
| XLogP | 2.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|