C12H20N2 — CID 90898811
(6-imino-1,4,4-trimethylcycloocta-2,7-dien-1-yl)methanamine (PubChem CID 90898811) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (6-imino-1,4,4-trimethylcycloocta-2,7-dien-1-yl)methanamine.
| Compound Name | (6-imino-1,4,4-trimethylcycloocta-2,7-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 90898811 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (6-imino-1,4,4-trimethylcycloocta-2,7-dien-1-yl)methanamine |
| SMILES | [H]/N=C1\C=CC(C)(CN)C=CC(C)(C)C1 |
| InChI | InChI=1S/C12H20N2/c1-11(2)6-7-12(3,9-13)5-4-10(14)8-11/h4-7,14H,8-9,13H2,1-3H3/b5-4?,7-6?,14-10+ |
| InChIKey | HOHOIZPPXQMTFW-JVWSMANWSA-N |
| XLogP | 2.51 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|