C10H14N2 — CID 91589028
2-tert-butylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 91589028) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-tert-butylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 2-tert-butylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 91589028 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-tert-butylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C10H14N2/c1-10(2,3)8-6-7(11)4-5-9(8)12/h4-6,11-12H,1-3H3/b11-7+,12-9+ |
| InChIKey | VWJFXOYWEJSSIA-HNWKWBPYSA-N |
| XLogP | 2.57 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|