C12H14N2 — CID 70006995
2,3-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine (PubChem CID 70006995) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2,3-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 2,3-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 70006995 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,3-bis(prop-2-enyl)cyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])C(CC=C)=C1CC=C |
| InChI | InChI=1S/C12H14N2/c1-3-5-9-10(6-4-2)12(14)8-7-11(9)13/h3-4,7-8,13-14H,1-2,5-6H2/b13-11+,14-12+ |
| InChIKey | YAALDVAIGGZMRL-PHEQNACWSA-N |
| XLogP | 3.04 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|