C13H18IN3 — CID 163892384
(6E,9Z)-5-ethenyl-4-imino-3-(iodohydrazinylidene)undeca-1,6,9-triene (PubChem CID 163892384) has the molecular formula C13H18IN3 and a molecular weight of 343.21 g/mol. Its IUPAC name is (6E,9Z)-5-ethenyl-4-imino-3-(iodohydrazinylidene)undeca-1,6,9-triene.
| Compound Name | (6E,9Z)-5-ethenyl-4-imino-3-(iodohydrazinylidene)undeca-1,6,9-triene |
|---|---|
| PubChem CID | 163892384 |
| Molecular Formula | C13H18IN3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (6E,9Z)-5-ethenyl-4-imino-3-(iodohydrazinylidene)undeca-1,6,9-triene |
| SMILES | [H]/N=C(\C(C=C)=NNI)C(C=C)/C=C/C/C=C\C |
| InChI | InChI=1S/C13H18IN3/c1-4-7-8-9-10-11(5-2)13(15)12(6-3)16-17-14/h4-7,9-11,15,17H,2-3,8H2,1H3/b7-4-,10-9+,15-13-,16-12? |
| InChIKey | OPJMPGHDNABWEU-UIAYZTQDSA-N |
| XLogP | 3.81 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|