C10H17N — CID 91416730
(2Z)-6-methylnona-2,7-dien-4-imine (PubChem CID 91416730) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2Z)-6-methylnona-2,7-dien-4-imine.
| Compound Name | (2Z)-6-methylnona-2,7-dien-4-imine |
|---|---|
| PubChem CID | 91416730 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2Z)-6-methylnona-2,7-dien-4-imine |
| SMILES | [H]/N=C(\C=C/C)CC(C)C=CC |
| InChI | InChI=1S/C10H17N/c1-4-6-9(3)8-10(11)7-5-2/h4-7,9,11H,8H2,1-3H3/b6-4?,7-5-,11-10+ |
| InChIKey | UWCSNVJEBGIADG-QFWQHYFTSA-N |
| XLogP | 3.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|