C11H20F3N — CID 156717512
(Z)-2-methylhex-4-en-3-imine;1,1,1-trifluorobutane (PubChem CID 156717512) has the molecular formula C11H20F3N and a molecular weight of 223.28 g/mol. Its IUPAC name is (Z)-2-methylhex-4-en-3-imine;1,1,1-trifluorobutane.
| Compound Name | (Z)-2-methylhex-4-en-3-imine;1,1,1-trifluorobutane |
|---|---|
| PubChem CID | 156717512 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | (Z)-2-methylhex-4-en-3-imine;1,1,1-trifluorobutane |
| SMILES | CCCC(F)(F)F.[H]/N=C(/C=C\C)C(C)C |
| InChI | InChI=1S/C7H13N.C4H7F3/c1-4-5-7(8)6(2)3;1-2-3-4(5,6)7/h4-6,8H,1-3H3;2-3H2,1H3/b5-4-,8-7-; |
| InChIKey | YWUHUIZSTDSPRH-GAVCLPFXSA-N |
| XLogP | 4.59 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|