About 2-methyloct-5-en-4-imine
2-methyloct-5-en-4-imine (PubChem CID 90985822) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 2-methyloct-5-en-4-imine.
Molecular Properties
| Compound Name | 2-methyloct-5-en-4-imine |
| PubChem CID | 90985822 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 2-methyloct-5-en-4-imine |
| SMILES | [H]/N=C(\C=CCC)CC(C)C |
| InChI | InChI=1S/C9H17N/c1-4-5-6-9(10)7-8(2)3/h5-6,8,10H,4,7H2,1-3H3/b6-5?,10-9+ |
| InChIKey | NPTMZUFNNDCZNU-ZFZICBQDSA-N |
| XLogP | 3.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloct-5-en-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloct-5-en-4-imine?
The IUPAC name of 2-methyloct-5-en-4-imine (CID 90985822) is 2-methyloct-5-en-4-imine.
What is the SMILES notation for 2-methyloct-5-en-4-imine?
The canonical SMILES for 2-methyloct-5-en-4-imine is [H]/N=C(\C=CCC)CC(C)C.
What is the InChIKey of 2-methyloct-5-en-4-imine?
The InChIKey is NPTMZUFNNDCZNU-ZFZICBQDSA-N. The full InChI is InChI=1S/C9H17N/c1-4-5-6-9(10)7-8(2)3/h5-6,8,10H,4,7H2,1-3H3/b6-5?,10-9+.
What are the key properties of 2-methyloct-5-en-4-imine?
2-methyloct-5-en-4-imine has a molecular weight of 139.24 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloct-5-en-4-imine is sourced from PubChem (CID 90985822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).