About 8-methylnon-7-en-2-imine
8-methylnon-7-en-2-imine (PubChem CID 90700434) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 8-methylnon-7-en-2-imine.
Molecular Properties
| Compound Name | 8-methylnon-7-en-2-imine |
| PubChem CID | 90700434 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 8-methylnon-7-en-2-imine |
| SMILES | [H]/N=C(\C)CCCCC=C(C)C |
| InChI | InChI=1S/C10H19N/c1-9(2)7-5-4-6-8-10(3)11/h7,11H,4-6,8H2,1-3H3/b11-10+ |
| InChIKey | ZDGSWXFTKVIROV-ZHACJKMWSA-N |
| XLogP | 3.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnon-7-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnon-7-en-2-imine?
The IUPAC name of 8-methylnon-7-en-2-imine (CID 90700434) is 8-methylnon-7-en-2-imine.
What is the SMILES notation for 8-methylnon-7-en-2-imine?
The canonical SMILES for 8-methylnon-7-en-2-imine is [H]/N=C(\C)CCCCC=C(C)C.
What is the InChIKey of 8-methylnon-7-en-2-imine?
The InChIKey is ZDGSWXFTKVIROV-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H19N/c1-9(2)7-5-4-6-8-10(3)11/h7,11H,4-6,8H2,1-3H3/b11-10+.
What are the key properties of 8-methylnon-7-en-2-imine?
8-methylnon-7-en-2-imine has a molecular weight of 153.27 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnon-7-en-2-imine is sourced from PubChem (CID 90700434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).