C11H17N — CID 89351746
(5Z)-5-methyl-4-propan-2-ylidenehepta-1,5-dien-3-imine (PubChem CID 89351746) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (5Z)-5-methyl-4-propan-2-ylidenehepta-1,5-dien-3-imine.
| Compound Name | (5Z)-5-methyl-4-propan-2-ylidenehepta-1,5-dien-3-imine |
|---|---|
| PubChem CID | 89351746 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (5Z)-5-methyl-4-propan-2-ylidenehepta-1,5-dien-3-imine |
| SMILES | C/C=C(/C)\C(=C(C)C)C(=N)C=C |
| InChI | InChI=1S/C11H17N/c1-6-9(5)11(8(3)4)10(12)7-2/h6-7,12H,2H2,1,3-5H3/b9-6-,12-10? |
| InChIKey | FXMYEHRTYWNZQC-UHSJMQQQSA-N |
| XLogP | 3.70 |
| TPSA | 23.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 250 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|