C17H29N — CID 91205691
5-ethyl-2-(3-methylheptan-2-yl)cyclohepta-2,6-dien-1-imine (PubChem CID 91205691) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 5-ethyl-2-(3-methylheptan-2-yl)cyclohepta-2,6-dien-1-imine.
| Compound Name | 5-ethyl-2-(3-methylheptan-2-yl)cyclohepta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 91205691 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 5-ethyl-2-(3-methylheptan-2-yl)cyclohepta-2,6-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(CC)CC=C1C(C)C(C)CCCC |
| InChI | InChI=1S/C17H29N/c1-5-7-8-13(3)14(4)16-11-9-15(6-2)10-12-17(16)18/h10-15,18H,5-9H2,1-4H3/b18-17+ |
| InChIKey | WQDZOKRTMZSUCI-ISLYRVAYSA-N |
| XLogP | 5.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|