C23H37N — CID 91153524
1-(4-ethylcyclonona-2,3,5,7-tetraen-1-yl)-N-methylundecan-2-imine (PubChem CID 91153524) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 1-(4-ethylcyclonona-2,3,5,7-tetraen-1-yl)-N-methylundecan-2-imine.
| Compound Name | 1-(4-ethylcyclonona-2,3,5,7-tetraen-1-yl)-N-methylundecan-2-imine |
|---|---|
| PubChem CID | 91153524 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 1-(4-ethylcyclonona-2,3,5,7-tetraen-1-yl)-N-methylundecan-2-imine |
| SMILES | CCCCCCCCC/C(CC1C=C=C(CC)C=CC=CC1)=N\C |
| InChI | InChI=1S/C23H37N/c1-4-6-7-8-9-10-14-17-23(24-3)20-22-16-13-11-12-15-21(5-2)18-19-22/h11-13,15,19,22H,4-10,14,16-17,20H2,1-3H3/b13-11?,15-12?,24-23+ |
| InChIKey | XETIBZHDZXXRGA-GSALIGSZSA-N |
| XLogP | 7.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|